CAS No: 10-28-6, Chemical Name: 5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione
the physical and chemical property of 10-28-6, 5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione is provided by ChemNet.com
ChemNet > CAS > 10-28-6 5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione
10-28-6 5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione
| product Name |
5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione |
| Synonyms |
|
| Molecular Formula |
C13H16O3 |
| Molecular Weight |
220.2643 |
| InChI |
InChI=1/C13H16O3/c1-13-5-4-9-10(7-16-12(9)15)11(13)3-2-8(14)6-13/h11H,2-7H2,1H3 |
| CAS Registry Number |
10-28-6 |
| Molecular Structure |
![10-28-6 5a-methyl-4,5a,6,8,9,9a-hexahydronaphtho[1,2-c]furan-3,7(1H,5H)-dione](http://www.qhyhsjc.com/suppliers/chembase/cas30/10-28-6.png)
|
| Density |
1.21g/cm3 |
| Boiling point |
417.9°C at 760 mmHg |
| Refractive index |
1.547 |
| Flash point |
189.2°C |
| Vapour Pressur |
3.41E-07mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
|
|
